About 1-but-1-enoxycyclohexa-2,4-diene-1-sulfonic acid
1-but-1-enoxycyclohexa-2,4-diene-1-sulfonic acid (PubChem CID 175251440) has the molecular formula C10H14O4S
and a molecular weight of 230.28 g/mol. Its IUPAC name is 1-but-1-enoxycyclohexa-2,4-diene-1-sulfonic acid.
Molecular Properties
| Compound Name | 1-but-1-enoxycyclohexa-2,4-diene-1-sulfonic acid |
| PubChem CID | 175251440 |
| Molecular Formula | C10H14O4S |
| Molecular Weight | 230.28 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 1-but-1-enoxycyclohexa-2,4-diene-1-sulfonic acid |
| SMILES | CCC=COC1(S(=O)(=O)O)C=CC=CC1 |
| InChI | InChI=1S/C10H14O4S/c1-2-3-9-14-10(15(11,12)13)7-5-4-6-8-10/h3-7,9H,2,8H2,1H3,(H,11,12,13) |
| InChIKey | FUBFCXGSZIJBIR-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.28 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1-but-1-enoxycyclohexa-2,4-diene-1-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-but-1-enoxycyclohexa-2,4-diene-1-sulfonic acid?
The IUPAC name of 1-but-1-enoxycyclohexa-2,4-diene-1-sulfonic acid (CID 175251440) is 1-but-1-enoxycyclohexa-2,4-diene-1-sulfonic acid.
What is the SMILES notation for 1-but-1-enoxycyclohexa-2,4-diene-1-sulfonic acid?
The canonical SMILES for 1-but-1-enoxycyclohexa-2,4-diene-1-sulfonic acid is CCC=COC1(S(=O)(=O)O)C=CC=CC1.
What is the InChIKey of 1-but-1-enoxycyclohexa-2,4-diene-1-sulfonic acid?
The InChIKey is FUBFCXGSZIJBIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O4S/c1-2-3-9-14-10(15(11,12)13)7-5-4-6-8-10/h3-7,9H,2,8H2,1H3,(H,11,12,13).
What are the key properties of 1-but-1-enoxycyclohexa-2,4-diene-1-sulfonic acid?
1-but-1-enoxycyclohexa-2,4-diene-1-sulfonic acid has a molecular weight of 230.28 g/mol, XLogP of 2.03, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-but-1-enoxycyclohexa-2,4-diene-1-sulfonic acid is sourced from PubChem (CID 175251440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).