C34H30BrNO5 — CID 175251870
methyl 5-bromo-2-[1-nitro-3-(5,6,7,8-tetrahydrochrysen-1-yl)naphthalen-2-yl]oxypentanoate (PubChem CID 175251870) has the molecular formula C34H30BrNO5 and a molecular weight of 612.52 g/mol. Its IUPAC name is methyl 5-bromo-2-[1-nitro-3-(5,6,7,8-tetrahydrochrysen-1-yl)naphthalen-2-yl]oxypentanoate.
| Compound Name | methyl 5-bromo-2-[1-nitro-3-(5,6,7,8-tetrahydrochrysen-1-yl)naphthalen-2-yl]oxypentanoate |
|---|---|
| PubChem CID | 175251870 |
| Molecular Formula | C34H30BrNO5 |
| Molecular Weight | 612.52 g/mol |
| Exact Mass | 611.13 |
| IUPAC Name | methyl 5-bromo-2-[1-nitro-3-(5,6,7,8-tetrahydrochrysen-1-yl)naphthalen-2-yl]oxypentanoate |
| SMILES | COC(=O)C(CCCBr)Oc1c(-c2cccc3c4c(ccc23)C2=C(CCC=C2)CC4)cc2ccccc2c1[N+](=O)[O-] |
| InChI | InChI=1S/C34H30BrNO5/c1-40-34(37)31(14-7-19-35)41-33-30(20-22-9-3-5-11-24(22)32(33)36(38)39)26-13-6-12-25-28-16-15-21-8-2-4-10-23(21)27(28)17-18-29(25)26/h3-6,9-13,17-18,20,31H,2,7-8,14-16,19H2,1H3 |
| InChIKey | XUCIHVAIAYGSGX-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.52 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|