C11H15NO4S — CID 175251980
5-isothiocyanato-1,2,5,6-tetramethoxycyclohexa-1,3-diene (PubChem CID 175251980) has the molecular formula C11H15NO4S and a molecular weight of 257.31 g/mol. Its IUPAC name is 5-isothiocyanato-1,2,5,6-tetramethoxycyclohexa-1,3-diene.
| Compound Name | 5-isothiocyanato-1,2,5,6-tetramethoxycyclohexa-1,3-diene |
|---|---|
| PubChem CID | 175251980 |
| Molecular Formula | C11H15NO4S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 5-isothiocyanato-1,2,5,6-tetramethoxycyclohexa-1,3-diene |
| SMILES | COC1=C(OC)C(OC)C(N=C=S)(OC)C=C1 |
| InChI | InChI=1S/C11H15NO4S/c1-13-8-5-6-11(16-4,12-7-17)10(15-3)9(8)14-2/h5-6,10H,1-4H3 |
| InChIKey | SYERCIUBVMSMQX-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|