C19H18F2N6O2S2 — CID 175252502
5-[2-fluoro-5-[[4-(5-fluoro-2-pyridinyl)-1,3-thiazol-2-yl]amino]phenyl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine (PubChem CID 175252502) has the molecular formula C19H18F2N6O2S2 and a molecular weight of 464.52 g/mol. Its IUPAC name is 5-[2-fluoro-5-[[4-(5-fluoro-2-pyridinyl)-1,3-thiazol-2-yl]amino]phenyl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine.
| Compound Name | 5-[2-fluoro-5-[[4-(5-fluoro-2-pyridinyl)-1,3-thiazol-2-yl]amino]phenyl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine |
|---|---|
| PubChem CID | 175252502 |
| Molecular Formula | C19H18F2N6O2S2 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.09 |
| IUPAC Name | 5-[2-fluoro-5-[[4-(5-fluoro-2-pyridinyl)-1,3-thiazol-2-yl]amino]phenyl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine |
| SMILES | CN1C(N)=NC(C)(c2cc(Nc3nc(-c4ccc(F)cn4)cs3)ccc2F)CS1(=O)=O |
| InChI | InChI=1S/C19H18F2N6O2S2/c1-19(10-31(28,29)27(2)17(22)26-19)13-7-12(4-5-14(13)21)24-18-25-16(9-30-18)15-6-3-11(20)8-23-15/h3-9H,10H2,1-2H3,(H2,22,26)(H,24,25) |
| InChIKey | UWCOLRCQMZVKOW-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 113.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |