C15H22N2 — CID 175252747
1-[4-(1,2,3-trimethylcyclopenta-2,4-dien-1-yl)butyl]imidazole (PubChem CID 175252747) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 1-[4-(1,2,3-trimethylcyclopenta-2,4-dien-1-yl)butyl]imidazole.
| Compound Name | 1-[4-(1,2,3-trimethylcyclopenta-2,4-dien-1-yl)butyl]imidazole |
|---|---|
| PubChem CID | 175252747 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 1-[4-(1,2,3-trimethylcyclopenta-2,4-dien-1-yl)butyl]imidazole |
| SMILES | CC1=C(C)C(C)(CCCCn2ccnc2)C=C1 |
| InChI | InChI=1S/C15H22N2/c1-13-6-8-15(3,14(13)2)7-4-5-10-17-11-9-16-12-17/h6,8-9,11-12H,4-5,7,10H2,1-3H3 |
| InChIKey | QODFRIXJCGRXBX-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|