About N-[(2R)-1-(2,6-dimethylphenyl)piperidin-2-yl]formamide
N-[(2R)-1-(2,6-dimethylphenyl)piperidin-2-yl]formamide (PubChem CID 175252805) has the molecular formula C14H20N2O
and a molecular weight of 232.33 g/mol. Its IUPAC name is N-[(2R)-1-(2,6-dimethylphenyl)piperidin-2-yl]formamide.
Molecular Properties
| Compound Name | N-[(2R)-1-(2,6-dimethylphenyl)piperidin-2-yl]formamide |
| PubChem CID | 175252805 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | N-[(2R)-1-(2,6-dimethylphenyl)piperidin-2-yl]formamide |
| SMILES | Cc1cccc(C)c1N1CCCC[C@@H]1NC=O |
| InChI | InChI=1S/C14H20N2O/c1-11-6-5-7-12(2)14(11)16-9-4-3-8-13(16)15-10-17/h5-7,10,13H,3-4,8-9H2,1-2H3,(H,15,17)/t13-/m1/s1 |
| InChIKey | KYKNUTHYHGSORU-CYBMUJFWSA-N |
| XLogP | 2.37 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-[(2R)-1-(2,6-dimethylphenyl)piperidin-2-yl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2R)-1-(2,6-dimethylphenyl)piperidin-2-yl]formamide?
The IUPAC name of N-[(2R)-1-(2,6-dimethylphenyl)piperidin-2-yl]formamide (CID 175252805) is N-[(2R)-1-(2,6-dimethylphenyl)piperidin-2-yl]formamide.
What is the SMILES notation for N-[(2R)-1-(2,6-dimethylphenyl)piperidin-2-yl]formamide?
The canonical SMILES for N-[(2R)-1-(2,6-dimethylphenyl)piperidin-2-yl]formamide is Cc1cccc(C)c1N1CCCC[C@@H]1NC=O.
What is the InChIKey of N-[(2R)-1-(2,6-dimethylphenyl)piperidin-2-yl]formamide?
The InChIKey is KYKNUTHYHGSORU-CYBMUJFWSA-N. The full InChI is InChI=1S/C14H20N2O/c1-11-6-5-7-12(2)14(11)16-9-4-3-8-13(16)15-10-17/h5-7,10,13H,3-4,8-9H2,1-2H3,(H,15,17)/t13-/m1/s1.
What are the key properties of N-[(2R)-1-(2,6-dimethylphenyl)piperidin-2-yl]formamide?
N-[(2R)-1-(2,6-dimethylphenyl)piperidin-2-yl]formamide has a molecular weight of 232.33 g/mol, XLogP of 2.37, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2R)-1-(2,6-dimethylphenyl)piperidin-2-yl]formamide is sourced from PubChem (CID 175252805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).