About [7-(3-chlorophenyl)-3,4-dihydro-2H-chromen-4-yl] carbamate
[7-(3-chlorophenyl)-3,4-dihydro-2H-chromen-4-yl] carbamate (PubChem CID 175252999) has the molecular formula C16H14ClNO3
and a molecular weight of 303.75 g/mol. Its IUPAC name is [7-(3-chlorophenyl)-3,4-dihydro-2H-chromen-4-yl] carbamate.
Molecular Properties
| Compound Name | [7-(3-chlorophenyl)-3,4-dihydro-2H-chromen-4-yl] carbamate |
| PubChem CID | 175252999 |
| Molecular Formula | C16H14ClNO3 |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | [7-(3-chlorophenyl)-3,4-dihydro-2H-chromen-4-yl] carbamate |
| SMILES | NC(=O)OC1CCOc2cc(-c3cccc(Cl)c3)ccc21 |
| InChI | InChI=1S/C16H14ClNO3/c17-12-3-1-2-10(8-12)11-4-5-13-14(21-16(18)19)6-7-20-15(13)9-11/h1-5,8-9,14H,6-7H2,(H2,18,19) |
| InChIKey | LQWZHDVZHYOFFL-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [7-(3-chlorophenyl)-3,4-dihydro-2H-chromen-4-yl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [7-(3-chlorophenyl)-3,4-dihydro-2H-chromen-4-yl] carbamate?
The IUPAC name of [7-(3-chlorophenyl)-3,4-dihydro-2H-chromen-4-yl] carbamate (CID 175252999) is [7-(3-chlorophenyl)-3,4-dihydro-2H-chromen-4-yl] carbamate.
What is the SMILES notation for [7-(3-chlorophenyl)-3,4-dihydro-2H-chromen-4-yl] carbamate?
The canonical SMILES for [7-(3-chlorophenyl)-3,4-dihydro-2H-chromen-4-yl] carbamate is NC(=O)OC1CCOc2cc(-c3cccc(Cl)c3)ccc21.
What is the InChIKey of [7-(3-chlorophenyl)-3,4-dihydro-2H-chromen-4-yl] carbamate?
The InChIKey is LQWZHDVZHYOFFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14ClNO3/c17-12-3-1-2-10(8-12)11-4-5-13-14(21-16(18)19)6-7-20-15(13)9-11/h1-5,8-9,14H,6-7H2,(H2,18,19).
What are the key properties of [7-(3-chlorophenyl)-3,4-dihydro-2H-chromen-4-yl] carbamate?
[7-(3-chlorophenyl)-3,4-dihydro-2H-chromen-4-yl] carbamate has a molecular weight of 303.75 g/mol, XLogP of 3.93, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [7-(3-chlorophenyl)-3,4-dihydro-2H-chromen-4-yl] carbamate is sourced from PubChem (CID 175252999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).