C18H19FN2O3 — CID 175253227
[7-(2-fluoro-6-methyl-3-pyridinyl)-3,3-dimethyl-2,4-dihydrochromen-4-yl] carbamate (PubChem CID 175253227) has the molecular formula C18H19FN2O3 and a molecular weight of 330.36 g/mol. Its IUPAC name is [7-(2-fluoro-6-methyl-3-pyridinyl)-3,3-dimethyl-2,4-dihydrochromen-4-yl] carbamate.
| Compound Name | [7-(2-fluoro-6-methyl-3-pyridinyl)-3,3-dimethyl-2,4-dihydrochromen-4-yl] carbamate |
|---|---|
| PubChem CID | 175253227 |
| Molecular Formula | C18H19FN2O3 |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | [7-(2-fluoro-6-methyl-3-pyridinyl)-3,3-dimethyl-2,4-dihydrochromen-4-yl] carbamate |
| SMILES | Cc1ccc(-c2ccc3c(c2)OCC(C)(C)C3OC(N)=O)c(F)n1 |
| InChI | InChI=1S/C18H19FN2O3/c1-10-4-6-12(16(19)21-10)11-5-7-13-14(8-11)23-9-18(2,3)15(13)24-17(20)22/h4-8,15H,9H2,1-3H3,(H2,20,22) |
| InChIKey | SIMWXIMBKNNGPG-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|