C28H29NO7S — CID 175253369
2-[1-[(2S,5R)-5-[(E)-2-(benzenesulfonyl)ethenyl]-3-methylideneoxolan-2-yl]-5-methylhepta-5,6-dien-3-yl]-4-nitrobenzoic acid (PubChem CID 175253369) has the molecular formula C28H29NO7S and a molecular weight of 523.61 g/mol. Its IUPAC name is 2-[1-[(2S,5R)-5-[(E)-2-(benzenesulfonyl)ethenyl]-3-methylideneoxolan-2-yl]-5-methylhepta-5,6-dien-3-yl]-4-nitrobenzoic acid.
| Compound Name | 2-[1-[(2S,5R)-5-[(E)-2-(benzenesulfonyl)ethenyl]-3-methylideneoxolan-2-yl]-5-methylhepta-5,6-dien-3-yl]-4-nitrobenzoic acid |
|---|---|
| PubChem CID | 175253369 |
| Molecular Formula | C28H29NO7S |
| Molecular Weight | 523.61 g/mol |
| Exact Mass | 523.17 |
| IUPAC Name | 2-[1-[(2S,5R)-5-[(E)-2-(benzenesulfonyl)ethenyl]-3-methylideneoxolan-2-yl]-5-methylhepta-5,6-dien-3-yl]-4-nitrobenzoic acid |
| SMILES | C=C=C(C)CC(CC[C@@H]1O[C@@H](/C=C/S(=O)(=O)c2ccccc2)CC1=C)c1cc([N+](=O)[O-])ccc1C(=O)O |
| InChI | InChI=1S/C28H29NO7S/c1-4-19(2)16-21(26-18-22(29(32)33)11-12-25(26)28(30)31)10-13-27-20(3)17-23(36-27)14-15-37(34,35)24-8-6-5-7-9-24/h5-9,11-12,14-15,18,21,23,27H,1,3,10,13,16-17H2,2H3,(H,30,31)/b15-14+/t21?,23-,27-/m0/s1 |
| InChIKey | WGUZUKNCIVJTBB-LUEZGQJQSA-N |
| XLogP | 5.98 |
| TPSA | 123.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.61 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|