C22H21BrO — CID 175253719
8-bromo-1-methyl-7-prop-2-enoxy-2,3,4,5-tetrahydrochrysene (PubChem CID 175253719) has the molecular formula C22H21BrO and a molecular weight of 381.31 g/mol. Its IUPAC name is 8-bromo-1-methyl-7-prop-2-enoxy-2,3,4,5-tetrahydrochrysene.
| Compound Name | 8-bromo-1-methyl-7-prop-2-enoxy-2,3,4,5-tetrahydrochrysene |
|---|---|
| PubChem CID | 175253719 |
| Molecular Formula | C22H21BrO |
| Molecular Weight | 381.31 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | 8-bromo-1-methyl-7-prop-2-enoxy-2,3,4,5-tetrahydrochrysene |
| SMILES | C=CCOc1c(Br)ccc2c1=CCc1c3c(ccc1=2)=C(C)CCC3 |
| InChI | InChI=1S/C22H21BrO/c1-3-13-24-22-20-10-9-17-16-6-4-5-14(2)15(16)7-8-18(17)19(20)11-12-21(22)23/h3,7-8,10-12H,1,4-6,9,13H2,2H3 |
| InChIKey | XALQXONMDKAZMF-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.31 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|