About 3,4-bis(trifluoromethyl)pyrrolidine-2,5-dione;zinc
3,4-bis(trifluoromethyl)pyrrolidine-2,5-dione;zinc (PubChem CID 175254452) has the molecular formula C6H3F6NO2Zn
and a molecular weight of 300.47 g/mol. Its IUPAC name is 3,4-bis(trifluoromethyl)pyrrolidine-2,5-dione;zinc.
Molecular Properties
| Compound Name | 3,4-bis(trifluoromethyl)pyrrolidine-2,5-dione;zinc |
| PubChem CID | 175254452 |
| Molecular Formula | C6H3F6NO2Zn |
| Molecular Weight | 300.47 g/mol |
| Exact Mass | 298.94 |
| IUPAC Name | 3,4-bis(trifluoromethyl)pyrrolidine-2,5-dione;zinc |
| SMILES | O=C1NC(=O)C(C(F)(F)F)C1C(F)(F)F.[Zn] |
| InChI | InChI=1S/C6H3F6NO2.Zn/c7-5(8,9)1-2(6(10,11)12)4(15)13-3(1)14;/h1-2H,(H,13,14,15); |
| InChIKey | BSPNOAAQXAMGLH-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.47 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3,4-bis(trifluoromethyl)pyrrolidine-2,5-dione;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-bis(trifluoromethyl)pyrrolidine-2,5-dione;zinc?
The IUPAC name of 3,4-bis(trifluoromethyl)pyrrolidine-2,5-dione;zinc (CID 175254452) is 3,4-bis(trifluoromethyl)pyrrolidine-2,5-dione;zinc.
What is the SMILES notation for 3,4-bis(trifluoromethyl)pyrrolidine-2,5-dione;zinc?
The canonical SMILES for 3,4-bis(trifluoromethyl)pyrrolidine-2,5-dione;zinc is O=C1NC(=O)C(C(F)(F)F)C1C(F)(F)F.[Zn].
What is the InChIKey of 3,4-bis(trifluoromethyl)pyrrolidine-2,5-dione;zinc?
The InChIKey is BSPNOAAQXAMGLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3F6NO2.Zn/c7-5(8,9)1-2(6(10,11)12)4(15)13-3(1)14;/h1-2H,(H,13,14,15);.
What are the key properties of 3,4-bis(trifluoromethyl)pyrrolidine-2,5-dione;zinc?
3,4-bis(trifluoromethyl)pyrrolidine-2,5-dione;zinc has a molecular weight of 300.47 g/mol, XLogP of 1.00, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-bis(trifluoromethyl)pyrrolidine-2,5-dione;zinc is sourced from PubChem (CID 175254452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).