About 1-benzothiophene;pyrrolo[3,2-a]carbazole
1-benzothiophene;pyrrolo[3,2-a]carbazole (PubChem CID 175254659) has the molecular formula C22H14N2S
and a molecular weight of 338.44 g/mol. Its IUPAC name is 1-benzothiophene;pyrrolo[3,2-a]carbazole.
Molecular Properties
| Compound Name | 1-benzothiophene;pyrrolo[3,2-a]carbazole |
| PubChem CID | 175254659 |
| Molecular Formula | C22H14N2S |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 1-benzothiophene;pyrrolo[3,2-a]carbazole |
| SMILES | C1=Cc2c3c(ccc2=N1)=c1ccccc1=N3.c1ccc2sccc2c1 |
| InChI | InChI=1S/C14H8N2.C8H6S/c1-2-4-13-9(3-1)10-5-6-12-11(7-8-15-12)14(10)16-13;1-2-4-8-7(3-1)5-6-9-8/h1-8H;1-6H |
| InChIKey | GISVTQXGYBPVKU-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-benzothiophene;pyrrolo[3,2-a]carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzothiophene;pyrrolo[3,2-a]carbazole?
The IUPAC name of 1-benzothiophene;pyrrolo[3,2-a]carbazole (CID 175254659) is 1-benzothiophene;pyrrolo[3,2-a]carbazole.
What is the SMILES notation for 1-benzothiophene;pyrrolo[3,2-a]carbazole?
The canonical SMILES for 1-benzothiophene;pyrrolo[3,2-a]carbazole is C1=Cc2c3c(ccc2=N1)=c1ccccc1=N3.c1ccc2sccc2c1.
What is the InChIKey of 1-benzothiophene;pyrrolo[3,2-a]carbazole?
The InChIKey is GISVTQXGYBPVKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8N2.C8H6S/c1-2-4-13-9(3-1)10-5-6-12-11(7-8-15-12)14(10)16-13;1-2-4-8-7(3-1)5-6-9-8/h1-8H;1-6H.
What are the key properties of 1-benzothiophene;pyrrolo[3,2-a]carbazole?
1-benzothiophene;pyrrolo[3,2-a]carbazole has a molecular weight of 338.44 g/mol, XLogP of 4.74, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzothiophene;pyrrolo[3,2-a]carbazole is sourced from PubChem (CID 175254659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).