C21H14Br3N3 — CID 175255244
2,4,6-tris(4-bromophenyl)-1,4-dihydro-1,3,5-triazine (PubChem CID 175255244) has the molecular formula C21H14Br3N3 and a molecular weight of 548.08 g/mol. Its IUPAC name is 2,4,6-tris(4-bromophenyl)-1,4-dihydro-1,3,5-triazine.
| Compound Name | 2,4,6-tris(4-bromophenyl)-1,4-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 175255244 |
| Molecular Formula | C21H14Br3N3 |
| Molecular Weight | 548.08 g/mol |
| Exact Mass | 544.87 |
| IUPAC Name | 2,4,6-tris(4-bromophenyl)-1,4-dihydro-1,3,5-triazine |
| SMILES | Brc1ccc(C2=NC(c3ccc(Br)cc3)N=C(c3ccc(Br)cc3)N2)cc1 |
| InChI | InChI=1S/C21H14Br3N3/c22-16-7-1-13(2-8-16)19-25-20(14-3-9-17(23)10-4-14)27-21(26-19)15-5-11-18(24)12-6-15/h1-12,19H,(H,25,26,27) |
| InChIKey | KDISYJBPOOZJOA-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.08 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |