About 1-benzyl-5-N-butyl-4-oxo-3-N-(2-phenylpropyl)pyridine-3,5-dicarboxamide
1-benzyl-5-N-butyl-4-oxo-3-N-(2-phenylpropyl)pyridine-3,5-dicarboxamide (PubChem CID 175255289) has the molecular formula C27H31N3O3
and a molecular weight of 445.56 g/mol. Its IUPAC name is 1-benzyl-5-N-butyl-4-oxo-3-N-(2-phenylpropyl)pyridine-3,5-dicarboxamide.
Molecular Properties
| Compound Name | 1-benzyl-5-N-butyl-4-oxo-3-N-(2-phenylpropyl)pyridine-3,5-dicarboxamide |
| PubChem CID | 175255289 |
| Molecular Formula | C27H31N3O3 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.24 |
| IUPAC Name | 1-benzyl-5-N-butyl-4-oxo-3-N-(2-phenylpropyl)pyridine-3,5-dicarboxamide |
| SMILES | CCCCNC(=O)c1cn(Cc2ccccc2)cc(C(=O)NCC(C)c2ccccc2)c1=O |
| InChI | InChI=1S/C27H31N3O3/c1-3-4-15-28-26(32)23-18-30(17-21-11-7-5-8-12-21)19-24(25(23)31)27(33)29-16-20(2)22-13-9-6-10-14-22/h5-14,18-20H,3-4,15-17H2,1-2H3,(H,28,32)(H,29,33) |
| InChIKey | ZEIWUZAQMQUXNV-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-5-N-butyl-4-oxo-3-N-(2-phenylpropyl)pyridine-3,5-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-5-N-butyl-4-oxo-3-N-(2-phenylpropyl)pyridine-3,5-dicarboxamide?
The IUPAC name of 1-benzyl-5-N-butyl-4-oxo-3-N-(2-phenylpropyl)pyridine-3,5-dicarboxamide (CID 175255289) is 1-benzyl-5-N-butyl-4-oxo-3-N-(2-phenylpropyl)pyridine-3,5-dicarboxamide.
What is the SMILES notation for 1-benzyl-5-N-butyl-4-oxo-3-N-(2-phenylpropyl)pyridine-3,5-dicarboxamide?
The canonical SMILES for 1-benzyl-5-N-butyl-4-oxo-3-N-(2-phenylpropyl)pyridine-3,5-dicarboxamide is CCCCNC(=O)c1cn(Cc2ccccc2)cc(C(=O)NCC(C)c2ccccc2)c1=O.
What is the InChIKey of 1-benzyl-5-N-butyl-4-oxo-3-N-(2-phenylpropyl)pyridine-3,5-dicarboxamide?
The InChIKey is ZEIWUZAQMQUXNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H31N3O3/c1-3-4-15-28-26(32)23-18-30(17-21-11-7-5-8-12-21)19-24(25(23)31)27(33)29-16-20(2)22-13-9-6-10-14-22/h5-14,18-20H,3-4,15-17H2,1-2H3,(H,28,32)(H,29,33).
What are the key properties of 1-benzyl-5-N-butyl-4-oxo-3-N-(2-phenylpropyl)pyridine-3,5-dicarboxamide?
1-benzyl-5-N-butyl-4-oxo-3-N-(2-phenylpropyl)pyridine-3,5-dicarboxamide has a molecular weight of 445.56 g/mol, XLogP of 3.96, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-5-N-butyl-4-oxo-3-N-(2-phenylpropyl)pyridine-3,5-dicarboxamide is sourced from PubChem (CID 175255289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).