About hydron;1-[(3-methylcyclopentyl)methyl]-4-phenylbenzene
hydron;1-[(3-methylcyclopentyl)methyl]-4-phenylbenzene (PubChem CID 175255375) has the molecular formula C19H23+
and a molecular weight of 251.39 g/mol. Its IUPAC name is hydron;1-[(3-methylcyclopentyl)methyl]-4-phenylbenzene.
Molecular Properties
| Compound Name | hydron;1-[(3-methylcyclopentyl)methyl]-4-phenylbenzene |
| PubChem CID | 175255375 |
| Molecular Formula | C19H23+ |
| Molecular Weight | 251.39 g/mol |
| Exact Mass | 251.18 |
| IUPAC Name | hydron;1-[(3-methylcyclopentyl)methyl]-4-phenylbenzene |
| SMILES | CC1CCC(Cc2ccc(-c3ccccc3)cc2)C1.[H+] |
| InChI | InChI=1S/C19H22/c1-15-7-8-17(13-15)14-16-9-11-19(12-10-16)18-5-3-2-4-6-18/h2-6,9-12,15,17H,7-8,13-14H2,1H3/p+1 |
| InChIKey | UWGAYLQYAQMLDO-UHFFFAOYSA-O |
| XLogP | 5.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 251.39 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze hydron;1-[(3-methylcyclopentyl)methyl]-4-phenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;1-[(3-methylcyclopentyl)methyl]-4-phenylbenzene?
The IUPAC name of hydron;1-[(3-methylcyclopentyl)methyl]-4-phenylbenzene (CID 175255375) is hydron;1-[(3-methylcyclopentyl)methyl]-4-phenylbenzene.
What is the SMILES notation for hydron;1-[(3-methylcyclopentyl)methyl]-4-phenylbenzene?
The canonical SMILES for hydron;1-[(3-methylcyclopentyl)methyl]-4-phenylbenzene is CC1CCC(Cc2ccc(-c3ccccc3)cc2)C1.[H+].
What is the InChIKey of hydron;1-[(3-methylcyclopentyl)methyl]-4-phenylbenzene?
The InChIKey is UWGAYLQYAQMLDO-UHFFFAOYSA-O. The full InChI is InChI=1S/C19H22/c1-15-7-8-17(13-15)14-16-9-11-19(12-10-16)18-5-3-2-4-6-18/h2-6,9-12,15,17H,7-8,13-14H2,1H3/p+1.
What are the key properties of hydron;1-[(3-methylcyclopentyl)methyl]-4-phenylbenzene?
hydron;1-[(3-methylcyclopentyl)methyl]-4-phenylbenzene has a molecular weight of 251.39 g/mol, XLogP of 5.44, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;1-[(3-methylcyclopentyl)methyl]-4-phenylbenzene is sourced from PubChem (CID 175255375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).