About ethanol;2-methylnaphthalene-1,4-dione
ethanol;2-methylnaphthalene-1,4-dione (PubChem CID 175255751) has the molecular formula C13H14O3
and a molecular weight of 218.25 g/mol. Its IUPAC name is ethanol;2-methylnaphthalene-1,4-dione.
Molecular Properties
| Compound Name | ethanol;2-methylnaphthalene-1,4-dione |
| PubChem CID | 175255751 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | ethanol;2-methylnaphthalene-1,4-dione |
| SMILES | CC1=CC(=O)c2ccccc2C1=O.CCO |
| InChI | InChI=1S/C11H8O2.C2H6O/c1-7-6-10(12)8-4-2-3-5-9(8)11(7)13;1-2-3/h2-6H,1H3;3H,2H2,1H3 |
| InChIKey | LDJJBTJMOVSKRI-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze ethanol;2-methylnaphthalene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;2-methylnaphthalene-1,4-dione?
The IUPAC name of ethanol;2-methylnaphthalene-1,4-dione (CID 175255751) is ethanol;2-methylnaphthalene-1,4-dione.
What is the SMILES notation for ethanol;2-methylnaphthalene-1,4-dione?
The canonical SMILES for ethanol;2-methylnaphthalene-1,4-dione is CC1=CC(=O)c2ccccc2C1=O.CCO.
What is the InChIKey of ethanol;2-methylnaphthalene-1,4-dione?
The InChIKey is LDJJBTJMOVSKRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8O2.C2H6O/c1-7-6-10(12)8-4-2-3-5-9(8)11(7)13;1-2-3/h2-6H,1H3;3H,2H2,1H3.
What are the key properties of ethanol;2-methylnaphthalene-1,4-dione?
ethanol;2-methylnaphthalene-1,4-dione has a molecular weight of 218.25 g/mol, XLogP of 2.01, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;2-methylnaphthalene-1,4-dione is sourced from PubChem (CID 175255751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).