C23H34F2N2O — CID 175256288
N-[1-[2,5-difluoro-4-[(1S,5S)-3,3,5-trimethylcyclohexyl]oxyphenyl]ethyl]-2-ethyl-2,3-dihydro-1H-pyrrol-4-amine (PubChem CID 175256288) has the molecular formula C23H34F2N2O and a molecular weight of 392.53 g/mol. Its IUPAC name is N-[1-[2,5-difluoro-4-[(1S,5S)-3,3,5-trimethylcyclohexyl]oxyphenyl]ethyl]-2-ethyl-2,3-dihydro-1H-pyrrol-4-amine.
| Compound Name | N-[1-[2,5-difluoro-4-[(1S,5S)-3,3,5-trimethylcyclohexyl]oxyphenyl]ethyl]-2-ethyl-2,3-dihydro-1H-pyrrol-4-amine |
|---|---|
| PubChem CID | 175256288 |
| Molecular Formula | C23H34F2N2O |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | N-[1-[2,5-difluoro-4-[(1S,5S)-3,3,5-trimethylcyclohexyl]oxyphenyl]ethyl]-2-ethyl-2,3-dihydro-1H-pyrrol-4-amine |
| SMILES | CCC1CC(NC(C)c2cc(F)c(O[C@H]3C[C@@H](C)CC(C)(C)C3)cc2F)=CN1 |
| InChI | InChI=1S/C23H34F2N2O/c1-6-16-8-17(13-26-16)27-15(3)19-9-21(25)22(10-20(19)24)28-18-7-14(2)11-23(4,5)12-18/h9-10,13-16,18,26-27H,6-8,11-12H2,1-5H3/t14-,15?,16?,18+/m1/s1 |
| InChIKey | VJEHQXDFTRJNON-IDMDMSBLSA-N |
| XLogP | 5.82 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |