About [4-[[4-(2,3-dimethylimidazol-4-yl)-5-fluoropyrimidin-2-yl]amino]phenyl]methanesulfinic acid
[4-[[4-(2,3-dimethylimidazol-4-yl)-5-fluoropyrimidin-2-yl]amino]phenyl]methanesulfinic acid (PubChem CID 175256739) has the molecular formula C16H16FN5O2S
and a molecular weight of 361.40 g/mol. Its IUPAC name is [4-[[4-(2,3-dimethylimidazol-4-yl)-5-fluoropyrimidin-2-yl]amino]phenyl]methanesulfinic acid.
Molecular Properties
| Compound Name | [4-[[4-(2,3-dimethylimidazol-4-yl)-5-fluoropyrimidin-2-yl]amino]phenyl]methanesulfinic acid |
| PubChem CID | 175256739 |
| Molecular Formula | C16H16FN5O2S |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | [4-[[4-(2,3-dimethylimidazol-4-yl)-5-fluoropyrimidin-2-yl]amino]phenyl]methanesulfinic acid |
| SMILES | Cc1ncc(-c2nc(Nc3ccc(CS(=O)O)cc3)ncc2F)n1C |
| InChI | InChI=1S/C16H16FN5O2S/c1-10-18-8-14(22(10)2)15-13(17)7-19-16(21-15)20-12-5-3-11(4-6-12)9-25(23)24/h3-8H,9H2,1-2H3,(H,23,24)(H,19,20,21) |
| InChIKey | SFVGFQQBIQZYMC-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze [4-[[4-(2,3-dimethylimidazol-4-yl)-5-fluoropyrimidin-2-yl]amino]phenyl]methanesulfinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[[4-(2,3-dimethylimidazol-4-yl)-5-fluoropyrimidin-2-yl]amino]phenyl]methanesulfinic acid?
The IUPAC name of [4-[[4-(2,3-dimethylimidazol-4-yl)-5-fluoropyrimidin-2-yl]amino]phenyl]methanesulfinic acid (CID 175256739) is [4-[[4-(2,3-dimethylimidazol-4-yl)-5-fluoropyrimidin-2-yl]amino]phenyl]methanesulfinic acid.
What is the SMILES notation for [4-[[4-(2,3-dimethylimidazol-4-yl)-5-fluoropyrimidin-2-yl]amino]phenyl]methanesulfinic acid?
The canonical SMILES for [4-[[4-(2,3-dimethylimidazol-4-yl)-5-fluoropyrimidin-2-yl]amino]phenyl]methanesulfinic acid is Cc1ncc(-c2nc(Nc3ccc(CS(=O)O)cc3)ncc2F)n1C.
What is the InChIKey of [4-[[4-(2,3-dimethylimidazol-4-yl)-5-fluoropyrimidin-2-yl]amino]phenyl]methanesulfinic acid?
The InChIKey is SFVGFQQBIQZYMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16FN5O2S/c1-10-18-8-14(22(10)2)15-13(17)7-19-16(21-15)20-12-5-3-11(4-6-12)9-25(23)24/h3-8H,9H2,1-2H3,(H,23,24)(H,19,20,21).
What are the key properties of [4-[[4-(2,3-dimethylimidazol-4-yl)-5-fluoropyrimidin-2-yl]amino]phenyl]methanesulfinic acid?
[4-[[4-(2,3-dimethylimidazol-4-yl)-5-fluoropyrimidin-2-yl]amino]phenyl]methanesulfinic acid has a molecular weight of 361.40 g/mol, XLogP of 2.79, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[[4-(2,3-dimethylimidazol-4-yl)-5-fluoropyrimidin-2-yl]amino]phenyl]methanesulfinic acid is sourced from PubChem (CID 175256739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).