C20H42O4Si2 — CID 175257344
tert-butyl-[(2R,3R,5R,6S)-5-dimethylsilyloxy-2-hex-5-en-2-yloxy-6-methyloxan-3-yl]oxy-dimethylsilane (PubChem CID 175257344) has the molecular formula C20H42O4Si2 and a molecular weight of 402.72 g/mol. Its IUPAC name is tert-butyl-[(2R,3R,5R,6S)-5-dimethylsilyloxy-2-hex-5-en-2-yloxy-6-methyloxan-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2R,3R,5R,6S)-5-dimethylsilyloxy-2-hex-5-en-2-yloxy-6-methyloxan-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 175257344 |
| Molecular Formula | C20H42O4Si2 |
| Molecular Weight | 402.72 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | tert-butyl-[(2R,3R,5R,6S)-5-dimethylsilyloxy-2-hex-5-en-2-yloxy-6-methyloxan-3-yl]oxy-dimethylsilane |
| SMILES | C=CCCC(C)O[C@@H]1O[C@@H](C)[C@H](O[SiH](C)C)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H42O4Si2/c1-11-12-13-15(2)21-19-18(24-26(9,10)20(4,5)6)14-17(16(3)22-19)23-25(7)8/h11,15-19,25H,1,12-14H2,2-10H3/t15?,16-,17+,18+,19+/m0/s1 |
| InChIKey | JDXPCATULZJTHZ-LHSROCTLSA-N |
| XLogP | 5.25 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.72 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|