About 2-[4-(2-fluorobutoxy)phenyl]benzene-1,3-dicarboxamide
2-[4-(2-fluorobutoxy)phenyl]benzene-1,3-dicarboxamide (PubChem CID 175257872) has the molecular formula C18H19FN2O3
and a molecular weight of 330.36 g/mol. Its IUPAC name is 2-[4-(2-fluorobutoxy)phenyl]benzene-1,3-dicarboxamide.
Molecular Properties
| Compound Name | 2-[4-(2-fluorobutoxy)phenyl]benzene-1,3-dicarboxamide |
| PubChem CID | 175257872 |
| Molecular Formula | C18H19FN2O3 |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 2-[4-(2-fluorobutoxy)phenyl]benzene-1,3-dicarboxamide |
| SMILES | CCC(F)COc1ccc(-c2c(C(N)=O)cccc2C(N)=O)cc1 |
| InChI | InChI=1S/C18H19FN2O3/c1-2-12(19)10-24-13-8-6-11(7-9-13)16-14(17(20)22)4-3-5-15(16)18(21)23/h3-9,12H,2,10H2,1H3,(H2,20,22)(H2,21,23) |
| InChIKey | WQSUGLQSEBOSKN-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[4-(2-fluorobutoxy)phenyl]benzene-1,3-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2-fluorobutoxy)phenyl]benzene-1,3-dicarboxamide?
The IUPAC name of 2-[4-(2-fluorobutoxy)phenyl]benzene-1,3-dicarboxamide (CID 175257872) is 2-[4-(2-fluorobutoxy)phenyl]benzene-1,3-dicarboxamide.
What is the SMILES notation for 2-[4-(2-fluorobutoxy)phenyl]benzene-1,3-dicarboxamide?
The canonical SMILES for 2-[4-(2-fluorobutoxy)phenyl]benzene-1,3-dicarboxamide is CCC(F)COc1ccc(-c2c(C(N)=O)cccc2C(N)=O)cc1.
What is the InChIKey of 2-[4-(2-fluorobutoxy)phenyl]benzene-1,3-dicarboxamide?
The InChIKey is WQSUGLQSEBOSKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19FN2O3/c1-2-12(19)10-24-13-8-6-11(7-9-13)16-14(17(20)22)4-3-5-15(16)18(21)23/h3-9,12H,2,10H2,1H3,(H2,20,22)(H2,21,23).
What are the key properties of 2-[4-(2-fluorobutoxy)phenyl]benzene-1,3-dicarboxamide?
2-[4-(2-fluorobutoxy)phenyl]benzene-1,3-dicarboxamide has a molecular weight of 330.36 g/mol, XLogP of 2.68, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2-fluorobutoxy)phenyl]benzene-1,3-dicarboxamide is sourced from PubChem (CID 175257872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).