About 2-(4-ethoxyphenyl)-3-(3,4,5-trimethoxyphenyl)aziridine
2-(4-ethoxyphenyl)-3-(3,4,5-trimethoxyphenyl)aziridine (PubChem CID 175257882) has the molecular formula C19H23NO4
and a molecular weight of 329.40 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-3-(3,4,5-trimethoxyphenyl)aziridine.
Molecular Properties
| Compound Name | 2-(4-ethoxyphenyl)-3-(3,4,5-trimethoxyphenyl)aziridine |
| PubChem CID | 175257882 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 2-(4-ethoxyphenyl)-3-(3,4,5-trimethoxyphenyl)aziridine |
| SMILES | CCOc1ccc(C2NC2c2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C19H23NO4/c1-5-24-14-8-6-12(7-9-14)17-18(20-17)13-10-15(21-2)19(23-4)16(11-13)22-3/h6-11,17-18,20H,5H2,1-4H3 |
| InChIKey | BOGGJXRSUGNIGR-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 58.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-ethoxyphenyl)-3-(3,4,5-trimethoxyphenyl)aziridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-ethoxyphenyl)-3-(3,4,5-trimethoxyphenyl)aziridine?
The IUPAC name of 2-(4-ethoxyphenyl)-3-(3,4,5-trimethoxyphenyl)aziridine (CID 175257882) is 2-(4-ethoxyphenyl)-3-(3,4,5-trimethoxyphenyl)aziridine.
What is the SMILES notation for 2-(4-ethoxyphenyl)-3-(3,4,5-trimethoxyphenyl)aziridine?
The canonical SMILES for 2-(4-ethoxyphenyl)-3-(3,4,5-trimethoxyphenyl)aziridine is CCOc1ccc(C2NC2c2cc(OC)c(OC)c(OC)c2)cc1.
What is the InChIKey of 2-(4-ethoxyphenyl)-3-(3,4,5-trimethoxyphenyl)aziridine?
The InChIKey is BOGGJXRSUGNIGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23NO4/c1-5-24-14-8-6-12(7-9-14)17-18(20-17)13-10-15(21-2)19(23-4)16(11-13)22-3/h6-11,17-18,20H,5H2,1-4H3.
What are the key properties of 2-(4-ethoxyphenyl)-3-(3,4,5-trimethoxyphenyl)aziridine?
2-(4-ethoxyphenyl)-3-(3,4,5-trimethoxyphenyl)aziridine has a molecular weight of 329.40 g/mol, XLogP of 3.50, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-ethoxyphenyl)-3-(3,4,5-trimethoxyphenyl)aziridine is sourced from PubChem (CID 175257882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).