C15H24N2O6S — CID 175258132
5-[4-hydroxy-3-(1,1,4-trihydroxy-1,2,5-thiadiazolidin-2-yl)phenyl]-2,2-dimethylpentanoic acid (PubChem CID 175258132) has the molecular formula C15H24N2O6S and a molecular weight of 360.43 g/mol. Its IUPAC name is 5-[4-hydroxy-3-(1,1,4-trihydroxy-1,2,5-thiadiazolidin-2-yl)phenyl]-2,2-dimethylpentanoic acid.
| Compound Name | 5-[4-hydroxy-3-(1,1,4-trihydroxy-1,2,5-thiadiazolidin-2-yl)phenyl]-2,2-dimethylpentanoic acid |
|---|---|
| PubChem CID | 175258132 |
| Molecular Formula | C15H24N2O6S |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 5-[4-hydroxy-3-(1,1,4-trihydroxy-1,2,5-thiadiazolidin-2-yl)phenyl]-2,2-dimethylpentanoic acid |
| SMILES | CC(C)(CCCc1ccc(O)c(N2CC(O)NS2(O)O)c1)C(=O)O |
| InChI | InChI=1S/C15H24N2O6S/c1-15(2,14(20)21)7-3-4-10-5-6-12(18)11(8-10)17-9-13(19)16-24(17,22)23/h5-6,8,13,16,18-19,22-23H,3-4,7,9H2,1-2H3,(H,20,21) |
| InChIKey | ZMYNGDHCKHXLTJ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 133.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |