About tert-butyl formate;3-[5-fluoro-2-(trifluoromethyl)phenyl]-N-piperidin-4-ylprop-2-ene-1-sulfonamide
tert-butyl formate;3-[5-fluoro-2-(trifluoromethyl)phenyl]-N-piperidin-4-ylprop-2-ene-1-sulfonamide (PubChem CID 175258171) has the molecular formula C20H28F4N2O4S
and a molecular weight of 468.51 g/mol. Its IUPAC name is tert-butyl formate;3-[5-fluoro-2-(trifluoromethyl)phenyl]-N-piperidin-4-ylprop-2-ene-1-sulfonamide.
Molecular Properties
| Compound Name | tert-butyl formate;3-[5-fluoro-2-(trifluoromethyl)phenyl]-N-piperidin-4-ylprop-2-ene-1-sulfonamide |
| PubChem CID | 175258171 |
| Molecular Formula | C20H28F4N2O4S |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | tert-butyl formate;3-[5-fluoro-2-(trifluoromethyl)phenyl]-N-piperidin-4-ylprop-2-ene-1-sulfonamide |
| SMILES | CC(C)(C)OC=O.O=S(=O)(CC=Cc1cc(F)ccc1C(F)(F)F)NC1CCNCC1 |
| InChI | InChI=1S/C15H18F4N2O2S.C5H10O2/c16-12-3-4-14(15(17,18)19)11(10-12)2-1-9-24(22,23)21-13-5-7-20-8-6-13;1-5(2,3)7-4-6/h1-4,10,13,20-21H,5-9H2;4H,1-3H3 |
| InChIKey | DZNQBIBZCIDBDN-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl formate;3-[5-fluoro-2-(trifluoromethyl)phenyl]-N-piperidin-4-ylprop-2-ene-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl formate;3-[5-fluoro-2-(trifluoromethyl)phenyl]-N-piperidin-4-ylprop-2-ene-1-sulfonamide?
The IUPAC name of tert-butyl formate;3-[5-fluoro-2-(trifluoromethyl)phenyl]-N-piperidin-4-ylprop-2-ene-1-sulfonamide (CID 175258171) is tert-butyl formate;3-[5-fluoro-2-(trifluoromethyl)phenyl]-N-piperidin-4-ylprop-2-ene-1-sulfonamide.
What is the SMILES notation for tert-butyl formate;3-[5-fluoro-2-(trifluoromethyl)phenyl]-N-piperidin-4-ylprop-2-ene-1-sulfonamide?
The canonical SMILES for tert-butyl formate;3-[5-fluoro-2-(trifluoromethyl)phenyl]-N-piperidin-4-ylprop-2-ene-1-sulfonamide is CC(C)(C)OC=O.O=S(=O)(CC=Cc1cc(F)ccc1C(F)(F)F)NC1CCNCC1.
What is the InChIKey of tert-butyl formate;3-[5-fluoro-2-(trifluoromethyl)phenyl]-N-piperidin-4-ylprop-2-ene-1-sulfonamide?
The InChIKey is DZNQBIBZCIDBDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18F4N2O2S.C5H10O2/c16-12-3-4-14(15(17,18)19)11(10-12)2-1-9-24(22,23)21-13-5-7-20-8-6-13;1-5(2,3)7-4-6/h1-4,10,13,20-21H,5-9H2;4H,1-3H3.
What are the key properties of tert-butyl formate;3-[5-fluoro-2-(trifluoromethyl)phenyl]-N-piperidin-4-ylprop-2-ene-1-sulfonamide?
tert-butyl formate;3-[5-fluoro-2-(trifluoromethyl)phenyl]-N-piperidin-4-ylprop-2-ene-1-sulfonamide has a molecular weight of 468.51 g/mol, XLogP of 3.49, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl formate;3-[5-fluoro-2-(trifluoromethyl)phenyl]-N-piperidin-4-ylprop-2-ene-1-sulfonamide is sourced from PubChem (CID 175258171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).