About 1,3-dioxolan-2-one;4-ethenyl-1,3-dioxolan-2-one;hydrofluoride
1,3-dioxolan-2-one;4-ethenyl-1,3-dioxolan-2-one;hydrofluoride (PubChem CID 175258508) has the molecular formula C8H11FO6
and a molecular weight of 222.17 g/mol. Its IUPAC name is 1,3-dioxolan-2-one;4-ethenyl-1,3-dioxolan-2-one;hydrofluoride.
Molecular Properties
| Compound Name | 1,3-dioxolan-2-one;4-ethenyl-1,3-dioxolan-2-one;hydrofluoride |
| PubChem CID | 175258508 |
| Molecular Formula | C8H11FO6 |
| Molecular Weight | 222.17 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | 1,3-dioxolan-2-one;4-ethenyl-1,3-dioxolan-2-one;hydrofluoride |
| SMILES | C=CC1COC(=O)O1.F.O=C1OCCO1 |
| InChI | InChI=1S/C5H6O3.C3H4O3.FH/c1-2-4-3-7-5(6)8-4;4-3-5-1-2-6-3;/h2,4H,1,3H2;1-2H2;1H |
| InChIKey | XGWZOVYDAMPSBV-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.17 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dioxolan-2-one;4-ethenyl-1,3-dioxolan-2-one;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dioxolan-2-one;4-ethenyl-1,3-dioxolan-2-one;hydrofluoride?
The IUPAC name of 1,3-dioxolan-2-one;4-ethenyl-1,3-dioxolan-2-one;hydrofluoride (CID 175258508) is 1,3-dioxolan-2-one;4-ethenyl-1,3-dioxolan-2-one;hydrofluoride.
What is the SMILES notation for 1,3-dioxolan-2-one;4-ethenyl-1,3-dioxolan-2-one;hydrofluoride?
The canonical SMILES for 1,3-dioxolan-2-one;4-ethenyl-1,3-dioxolan-2-one;hydrofluoride is C=CC1COC(=O)O1.F.O=C1OCCO1.
What is the InChIKey of 1,3-dioxolan-2-one;4-ethenyl-1,3-dioxolan-2-one;hydrofluoride?
The InChIKey is XGWZOVYDAMPSBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6O3.C3H4O3.FH/c1-2-4-3-7-5(6)8-4;4-3-5-1-2-6-3;/h2,4H,1,3H2;1-2H2;1H.
What are the key properties of 1,3-dioxolan-2-one;4-ethenyl-1,3-dioxolan-2-one;hydrofluoride?
1,3-dioxolan-2-one;4-ethenyl-1,3-dioxolan-2-one;hydrofluoride has a molecular weight of 222.17 g/mol, XLogP of 1.01, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dioxolan-2-one;4-ethenyl-1,3-dioxolan-2-one;hydrofluoride is sourced from PubChem (CID 175258508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).