About azane;1,4-dibromobenzene
azane;1,4-dibromobenzene (PubChem CID 175259215) has the molecular formula C6H7Br2N
and a molecular weight of 252.94 g/mol. Its IUPAC name is azane;1,4-dibromobenzene.
Molecular Properties
| Compound Name | azane;1,4-dibromobenzene |
| PubChem CID | 175259215 |
| Molecular Formula | C6H7Br2N |
| Molecular Weight | 252.94 g/mol |
| Exact Mass | 250.89 |
| IUPAC Name | azane;1,4-dibromobenzene |
| SMILES | Brc1ccc(Br)cc1.N |
| InChI | InChI=1S/C6H4Br2.H3N/c7-5-1-2-6(8)4-3-5;/h1-4H;1H3 |
| InChIKey | LKQOSHXGVBFOFR-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.94 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze azane;1,4-dibromobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1,4-dibromobenzene?
The IUPAC name of azane;1,4-dibromobenzene (CID 175259215) is azane;1,4-dibromobenzene.
What is the SMILES notation for azane;1,4-dibromobenzene?
The canonical SMILES for azane;1,4-dibromobenzene is Brc1ccc(Br)cc1.N.
What is the InChIKey of azane;1,4-dibromobenzene?
The InChIKey is LKQOSHXGVBFOFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4Br2.H3N/c7-5-1-2-6(8)4-3-5;/h1-4H;1H3.
What are the key properties of azane;1,4-dibromobenzene?
azane;1,4-dibromobenzene has a molecular weight of 252.94 g/mol, XLogP of 3.37, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1,4-dibromobenzene is sourced from PubChem (CID 175259215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).