About fluorobenzene;methyl 2-[2-chloro-5-(1-prop-2-enylsulfonylpiperidin-3-yl)phenyl]acetate
fluorobenzene;methyl 2-[2-chloro-5-(1-prop-2-enylsulfonylpiperidin-3-yl)phenyl]acetate (PubChem CID 175259375) has the molecular formula C23H27ClFNO4S
and a molecular weight of 467.99 g/mol. Its IUPAC name is fluorobenzene;methyl 2-[2-chloro-5-(1-prop-2-enylsulfonylpiperidin-3-yl)phenyl]acetate.
Molecular Properties
| Compound Name | fluorobenzene;methyl 2-[2-chloro-5-(1-prop-2-enylsulfonylpiperidin-3-yl)phenyl]acetate |
| PubChem CID | 175259375 |
| Molecular Formula | C23H27ClFNO4S |
| Molecular Weight | 467.99 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | fluorobenzene;methyl 2-[2-chloro-5-(1-prop-2-enylsulfonylpiperidin-3-yl)phenyl]acetate |
| SMILES | C=CCS(=O)(=O)N1CCCC(c2ccc(Cl)c(CC(=O)OC)c2)C1.Fc1ccccc1 |
| InChI | InChI=1S/C17H22ClNO4S.C6H5F/c1-3-9-24(21,22)19-8-4-5-14(12-19)13-6-7-16(18)15(10-13)11-17(20)23-2;7-6-4-2-1-3-5-6/h3,6-7,10,14H,1,4-5,8-9,11-12H2,2H3;1-5H |
| InChIKey | QDZBZGLOFZYZEJ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 467.99 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze fluorobenzene;methyl 2-[2-chloro-5-(1-prop-2-enylsulfonylpiperidin-3-yl)phenyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluorobenzene;methyl 2-[2-chloro-5-(1-prop-2-enylsulfonylpiperidin-3-yl)phenyl]acetate?
The IUPAC name of fluorobenzene;methyl 2-[2-chloro-5-(1-prop-2-enylsulfonylpiperidin-3-yl)phenyl]acetate (CID 175259375) is fluorobenzene;methyl 2-[2-chloro-5-(1-prop-2-enylsulfonylpiperidin-3-yl)phenyl]acetate.
What is the SMILES notation for fluorobenzene;methyl 2-[2-chloro-5-(1-prop-2-enylsulfonylpiperidin-3-yl)phenyl]acetate?
The canonical SMILES for fluorobenzene;methyl 2-[2-chloro-5-(1-prop-2-enylsulfonylpiperidin-3-yl)phenyl]acetate is C=CCS(=O)(=O)N1CCCC(c2ccc(Cl)c(CC(=O)OC)c2)C1.Fc1ccccc1.
What is the InChIKey of fluorobenzene;methyl 2-[2-chloro-5-(1-prop-2-enylsulfonylpiperidin-3-yl)phenyl]acetate?
The InChIKey is QDZBZGLOFZYZEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22ClNO4S.C6H5F/c1-3-9-24(21,22)19-8-4-5-14(12-19)13-6-7-16(18)15(10-13)11-17(20)23-2;7-6-4-2-1-3-5-6/h3,6-7,10,14H,1,4-5,8-9,11-12H2,2H3;1-5H.
What are the key properties of fluorobenzene;methyl 2-[2-chloro-5-(1-prop-2-enylsulfonylpiperidin-3-yl)phenyl]acetate?
fluorobenzene;methyl 2-[2-chloro-5-(1-prop-2-enylsulfonylpiperidin-3-yl)phenyl]acetate has a molecular weight of 467.99 g/mol, XLogP of 4.58, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for fluorobenzene;methyl 2-[2-chloro-5-(1-prop-2-enylsulfonylpiperidin-3-yl)phenyl]acetate is sourced from PubChem (CID 175259375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).