C22H23F3N5O2S- — CID 175259408
[4-[4-[[(3R)-3-methyl-4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methyl]-1H-pyrazol-5-yl]phenyl]methanesulfinate (PubChem CID 175259408) has the molecular formula C22H23F3N5O2S- and a molecular weight of 478.52 g/mol. Its IUPAC name is [4-[4-[[(3R)-3-methyl-4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methyl]-1H-pyrazol-5-yl]phenyl]methanesulfinate.
| Compound Name | [4-[4-[[(3R)-3-methyl-4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methyl]-1H-pyrazol-5-yl]phenyl]methanesulfinate |
|---|---|
| PubChem CID | 175259408 |
| Molecular Formula | C22H23F3N5O2S- |
| Molecular Weight | 478.52 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | [4-[4-[[(3R)-3-methyl-4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methyl]-1H-pyrazol-5-yl]phenyl]methanesulfinate |
| SMILES | C[C@@H]1CN(Cc2cn[nH]c2-c2ccc(CS(=O)[O-])cc2)CCN1c1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C22H24F3N5O2S/c1-15-12-29(8-9-30(15)20-7-6-19(11-26-20)22(23,24)25)13-18-10-27-28-21(18)17-4-2-16(3-5-17)14-33(31)32/h2-7,10-11,15H,8-9,12-14H2,1H3,(H,27,28)(H,31,32)/p-1/t15-/m1/s1 |
| InChIKey | WRZRNXPDWZXBMW-OAHLLOKOSA-M |
| XLogP | 3.58 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.52 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|