C16H25NO4 — CID 175259856
(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4,4-bis(prop-2-enyl)pyrrolidine-2-carboxylic acid (PubChem CID 175259856) has the molecular formula C16H25NO4 and a molecular weight of 295.38 g/mol. Its IUPAC name is (2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4,4-bis(prop-2-enyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4,4-bis(prop-2-enyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 175259856 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | (2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4,4-bis(prop-2-enyl)pyrrolidine-2-carboxylic acid |
| SMILES | C=CCC1(CC=C)C[C@@H](C(=O)O)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C16H25NO4/c1-6-8-16(9-7-2)10-12(13(18)19)17(11-16)14(20)21-15(3,4)5/h6-7,12H,1-2,8-11H2,3-5H3,(H,18,19)/t12-/m0/s1 |
| InChIKey | QOUZWRCFHJDIOQ-LBPRGKRZSA-N |
| XLogP | 3.22 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|