C24H19F3O4S — CID 175260589
[furan-2-yl(1,2,3,4-tetrahydrochrysen-3-yl)methyl] trifluoromethanesulfonate (PubChem CID 175260589) has the molecular formula C24H19F3O4S and a molecular weight of 460.47 g/mol. Its IUPAC name is [furan-2-yl(1,2,3,4-tetrahydrochrysen-3-yl)methyl] trifluoromethanesulfonate.
| Compound Name | [furan-2-yl(1,2,3,4-tetrahydrochrysen-3-yl)methyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 175260589 |
| Molecular Formula | C24H19F3O4S |
| Molecular Weight | 460.47 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | [furan-2-yl(1,2,3,4-tetrahydrochrysen-3-yl)methyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(OC(c1ccco1)C1CCc2ccc3c(ccc4ccccc43)c2C1)C(F)(F)F |
| InChI | InChI=1S/C24H19F3O4S/c25-24(26,27)32(28,29)31-23(22-6-3-13-30-22)17-8-7-16-10-11-19-18-5-2-1-4-15(18)9-12-20(19)21(16)14-17/h1-6,9-13,17,23H,7-8,14H2 |
| InChIKey | LGFBWQFBBWSALG-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.47 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|