About acetic acid;methyl 2,2-diaminoacetate
acetic acid;methyl 2,2-diaminoacetate (PubChem CID 175261115) has the molecular formula C5H12N2O4
and a molecular weight of 164.16 g/mol. Its IUPAC name is acetic acid;methyl 2,2-diaminoacetate.
Molecular Properties
| Compound Name | acetic acid;methyl 2,2-diaminoacetate |
| PubChem CID | 175261115 |
| Molecular Formula | C5H12N2O4 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | acetic acid;methyl 2,2-diaminoacetate |
| SMILES | CC(=O)O.COC(=O)C(N)N |
| InChI | InChI=1S/C3H8N2O2.C2H4O2/c1-7-3(6)2(4)5;1-2(3)4/h2H,4-5H2,1H3;1H3,(H,3,4) |
| InChIKey | DVHFLYFMVPCLSB-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 115.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;methyl 2,2-diaminoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;methyl 2,2-diaminoacetate?
The IUPAC name of acetic acid;methyl 2,2-diaminoacetate (CID 175261115) is acetic acid;methyl 2,2-diaminoacetate.
What is the SMILES notation for acetic acid;methyl 2,2-diaminoacetate?
The canonical SMILES for acetic acid;methyl 2,2-diaminoacetate is CC(=O)O.COC(=O)C(N)N.
What is the InChIKey of acetic acid;methyl 2,2-diaminoacetate?
The InChIKey is DVHFLYFMVPCLSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8N2O2.C2H4O2/c1-7-3(6)2(4)5;1-2(3)4/h2H,4-5H2,1H3;1H3,(H,3,4).
What are the key properties of acetic acid;methyl 2,2-diaminoacetate?
acetic acid;methyl 2,2-diaminoacetate has a molecular weight of 164.16 g/mol, XLogP of -1.51, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;methyl 2,2-diaminoacetate is sourced from PubChem (CID 175261115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).