C30H29N3O2 — CID 175263099
5-[[4-butyl-1-(2-methoxyphenyl)-2-methyl-6-oxopyrimidin-5-yl]methyl]-2-phenylbenzonitrile (PubChem CID 175263099) has the molecular formula C30H29N3O2 and a molecular weight of 463.58 g/mol. Its IUPAC name is 5-[[4-butyl-1-(2-methoxyphenyl)-2-methyl-6-oxopyrimidin-5-yl]methyl]-2-phenylbenzonitrile.
| Compound Name | 5-[[4-butyl-1-(2-methoxyphenyl)-2-methyl-6-oxopyrimidin-5-yl]methyl]-2-phenylbenzonitrile |
|---|---|
| PubChem CID | 175263099 |
| Molecular Formula | C30H29N3O2 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | 5-[[4-butyl-1-(2-methoxyphenyl)-2-methyl-6-oxopyrimidin-5-yl]methyl]-2-phenylbenzonitrile |
| SMILES | CCCCc1nc(C)n(-c2ccccc2OC)c(=O)c1Cc1ccc(-c2ccccc2)c(C#N)c1 |
| InChI | InChI=1S/C30H29N3O2/c1-4-5-13-27-26(30(34)33(21(2)32-27)28-14-9-10-15-29(28)35-3)19-22-16-17-25(24(18-22)20-31)23-11-7-6-8-12-23/h6-12,14-18H,4-5,13,19H2,1-3H3 |
| InChIKey | BOPOYZPPHHVRGT-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |