C25H32N6O3S — CID 175263235
(E)-N-[3-(butylamino)prop-2-enylsulfonyl]-3-[5-(5-cyclopropylpyrrolo[2,3-b]pyridin-1-yl)-1,3-dimethylpyrazol-4-yl]prop-2-enamide (PubChem CID 175263235) has the molecular formula C25H32N6O3S and a molecular weight of 496.64 g/mol. Its IUPAC name is (E)-N-[3-(butylamino)prop-2-enylsulfonyl]-3-[5-(5-cyclopropylpyrrolo[2,3-b]pyridin-1-yl)-1,3-dimethylpyrazol-4-yl]prop-2-enamide.
| Compound Name | (E)-N-[3-(butylamino)prop-2-enylsulfonyl]-3-[5-(5-cyclopropylpyrrolo[2,3-b]pyridin-1-yl)-1,3-dimethylpyrazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 175263235 |
| Molecular Formula | C25H32N6O3S |
| Molecular Weight | 496.64 g/mol |
| Exact Mass | 496.23 |
| IUPAC Name | (E)-N-[3-(butylamino)prop-2-enylsulfonyl]-3-[5-(5-cyclopropylpyrrolo[2,3-b]pyridin-1-yl)-1,3-dimethylpyrazol-4-yl]prop-2-enamide |
| SMILES | CCCCNC=CCS(=O)(=O)NC(=O)/C=C/c1c(C)nn(C)c1-n1ccc2cc(C3CC3)cnc21 |
| InChI | InChI=1S/C25H32N6O3S/c1-4-5-12-26-13-6-15-35(33,34)29-23(32)10-9-22-18(2)28-30(3)25(22)31-14-11-20-16-21(19-7-8-19)17-27-24(20)31/h6,9-11,13-14,16-17,19,26H,4-5,7-8,12,15H2,1-3H3,(H,29,32)/b10-9+,13-6? |
| InChIKey | VYVGNWVWKWWXDG-ARAVYZESSA-N |
| XLogP | 3.31 |
| TPSA | 110.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.64 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|