About 2-[1-(2,2-dimethylpropanoyloxy)ethyl]-2-(3-methylsulfonyloxypropyl)pyrrolidine-1-carboxylic acid
2-[1-(2,2-dimethylpropanoyloxy)ethyl]-2-(3-methylsulfonyloxypropyl)pyrrolidine-1-carboxylic acid (PubChem CID 175263297) has the molecular formula C16H29NO7S
and a molecular weight of 379.48 g/mol. Its IUPAC name is 2-[1-(2,2-dimethylpropanoyloxy)ethyl]-2-(3-methylsulfonyloxypropyl)pyrrolidine-1-carboxylic acid.
Molecular Properties
| Compound Name | 2-[1-(2,2-dimethylpropanoyloxy)ethyl]-2-(3-methylsulfonyloxypropyl)pyrrolidine-1-carboxylic acid |
| PubChem CID | 175263297 |
| Molecular Formula | C16H29NO7S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 2-[1-(2,2-dimethylpropanoyloxy)ethyl]-2-(3-methylsulfonyloxypropyl)pyrrolidine-1-carboxylic acid |
| SMILES | CC(OC(=O)C(C)(C)C)C1(CCCOS(C)(=O)=O)CCCN1C(=O)O |
| InChI | InChI=1S/C16H29NO7S/c1-12(24-13(18)15(2,3)4)16(8-6-10-17(16)14(19)20)9-7-11-23-25(5,21)22/h12H,6-11H2,1-5H3,(H,19,20) |
| InChIKey | ZXJVNWULADUAAB-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-(2,2-dimethylpropanoyloxy)ethyl]-2-(3-methylsulfonyloxypropyl)pyrrolidine-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(2,2-dimethylpropanoyloxy)ethyl]-2-(3-methylsulfonyloxypropyl)pyrrolidine-1-carboxylic acid?
The IUPAC name of 2-[1-(2,2-dimethylpropanoyloxy)ethyl]-2-(3-methylsulfonyloxypropyl)pyrrolidine-1-carboxylic acid (CID 175263297) is 2-[1-(2,2-dimethylpropanoyloxy)ethyl]-2-(3-methylsulfonyloxypropyl)pyrrolidine-1-carboxylic acid.
What is the SMILES notation for 2-[1-(2,2-dimethylpropanoyloxy)ethyl]-2-(3-methylsulfonyloxypropyl)pyrrolidine-1-carboxylic acid?
The canonical SMILES for 2-[1-(2,2-dimethylpropanoyloxy)ethyl]-2-(3-methylsulfonyloxypropyl)pyrrolidine-1-carboxylic acid is CC(OC(=O)C(C)(C)C)C1(CCCOS(C)(=O)=O)CCCN1C(=O)O.
What is the InChIKey of 2-[1-(2,2-dimethylpropanoyloxy)ethyl]-2-(3-methylsulfonyloxypropyl)pyrrolidine-1-carboxylic acid?
The InChIKey is ZXJVNWULADUAAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H29NO7S/c1-12(24-13(18)15(2,3)4)16(8-6-10-17(16)14(19)20)9-7-11-23-25(5,21)22/h12H,6-11H2,1-5H3,(H,19,20).
What are the key properties of 2-[1-(2,2-dimethylpropanoyloxy)ethyl]-2-(3-methylsulfonyloxypropyl)pyrrolidine-1-carboxylic acid?
2-[1-(2,2-dimethylpropanoyloxy)ethyl]-2-(3-methylsulfonyloxypropyl)pyrrolidine-1-carboxylic acid has a molecular weight of 379.48 g/mol, XLogP of 2.23, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(2,2-dimethylpropanoyloxy)ethyl]-2-(3-methylsulfonyloxypropyl)pyrrolidine-1-carboxylic acid is sourced from PubChem (CID 175263297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).