About 1-bromo-3-fluorobenzene;methoxycyclopentane
1-bromo-3-fluorobenzene;methoxycyclopentane (PubChem CID 175263771) has the molecular formula C12H16BrFO
and a molecular weight of 275.16 g/mol. Its IUPAC name is 1-bromo-3-fluorobenzene;methoxycyclopentane.
Molecular Properties
| Compound Name | 1-bromo-3-fluorobenzene;methoxycyclopentane |
| PubChem CID | 175263771 |
| Molecular Formula | C12H16BrFO |
| Molecular Weight | 275.16 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | 1-bromo-3-fluorobenzene;methoxycyclopentane |
| SMILES | COC1CCCC1.Fc1cccc(Br)c1 |
| InChI | InChI=1S/C6H4BrF.C6H12O/c7-5-2-1-3-6(8)4-5;1-7-6-4-2-3-5-6/h1-4H;6H,2-5H2,1H3 |
| InChIKey | UEZAGVMQRTZAHY-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.16 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-bromo-3-fluorobenzene;methoxycyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-3-fluorobenzene;methoxycyclopentane?
The IUPAC name of 1-bromo-3-fluorobenzene;methoxycyclopentane (CID 175263771) is 1-bromo-3-fluorobenzene;methoxycyclopentane.
What is the SMILES notation for 1-bromo-3-fluorobenzene;methoxycyclopentane?
The canonical SMILES for 1-bromo-3-fluorobenzene;methoxycyclopentane is COC1CCCC1.Fc1cccc(Br)c1.
What is the InChIKey of 1-bromo-3-fluorobenzene;methoxycyclopentane?
The InChIKey is UEZAGVMQRTZAHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4BrF.C6H12O/c7-5-2-1-3-6(8)4-5;1-7-6-4-2-3-5-6/h1-4H;6H,2-5H2,1H3.
What are the key properties of 1-bromo-3-fluorobenzene;methoxycyclopentane?
1-bromo-3-fluorobenzene;methoxycyclopentane has a molecular weight of 275.16 g/mol, XLogP of 4.16, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-3-fluorobenzene;methoxycyclopentane is sourced from PubChem (CID 175263771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).