About 3-bromoprop-1-yne;1,4-xylene
3-bromoprop-1-yne;1,4-xylene (PubChem CID 175263887) has the molecular formula C11H13Br
and a molecular weight of 225.13 g/mol. Its IUPAC name is 3-bromoprop-1-yne;1,4-xylene.
Molecular Properties
| Compound Name | 3-bromoprop-1-yne;1,4-xylene |
| PubChem CID | 175263887 |
| Molecular Formula | C11H13Br |
| Molecular Weight | 225.13 g/mol |
| Exact Mass | 224.02 |
| IUPAC Name | 3-bromoprop-1-yne;1,4-xylene |
| SMILES | C#CCBr.Cc1ccc(C)cc1 |
| InChI | InChI=1S/C8H10.C3H3Br/c1-7-3-5-8(2)6-4-7;1-2-3-4/h3-6H,1-2H3;1H,3H2 |
| InChIKey | UULXVPHVBYVTBM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.13 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-bromoprop-1-yne;1,4-xylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromoprop-1-yne;1,4-xylene?
The IUPAC name of 3-bromoprop-1-yne;1,4-xylene (CID 175263887) is 3-bromoprop-1-yne;1,4-xylene.
What is the SMILES notation for 3-bromoprop-1-yne;1,4-xylene?
The canonical SMILES for 3-bromoprop-1-yne;1,4-xylene is C#CCBr.Cc1ccc(C)cc1.
What is the InChIKey of 3-bromoprop-1-yne;1,4-xylene?
The InChIKey is UULXVPHVBYVTBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10.C3H3Br/c1-7-3-5-8(2)6-4-7;1-2-3-4/h3-6H,1-2H3;1H,3H2.
What are the key properties of 3-bromoprop-1-yne;1,4-xylene?
3-bromoprop-1-yne;1,4-xylene has a molecular weight of 225.13 g/mol, XLogP of 3.32, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromoprop-1-yne;1,4-xylene is sourced from PubChem (CID 175263887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).