C34H45N5O5 — CID 175264055
2-[(1R)-1-(3,4-dimethoxyphenyl)-4-[(4,6-dimethoxy-2-pyridinyl)amino]butyl]-4-(4-ethylpiperazin-1-yl)-1,3-dihydroisoindole-1-carbaldehyde (PubChem CID 175264055) has the molecular formula C34H45N5O5 and a molecular weight of 603.76 g/mol. Its IUPAC name is 2-[(1R)-1-(3,4-dimethoxyphenyl)-4-[(4,6-dimethoxy-2-pyridinyl)amino]butyl]-4-(4-ethylpiperazin-1-yl)-1,3-dihydroisoindole-1-carbaldehyde.
| Compound Name | 2-[(1R)-1-(3,4-dimethoxyphenyl)-4-[(4,6-dimethoxy-2-pyridinyl)amino]butyl]-4-(4-ethylpiperazin-1-yl)-1,3-dihydroisoindole-1-carbaldehyde |
|---|---|
| PubChem CID | 175264055 |
| Molecular Formula | C34H45N5O5 |
| Molecular Weight | 603.76 g/mol |
| Exact Mass | 603.34 |
| IUPAC Name | 2-[(1R)-1-(3,4-dimethoxyphenyl)-4-[(4,6-dimethoxy-2-pyridinyl)amino]butyl]-4-(4-ethylpiperazin-1-yl)-1,3-dihydroisoindole-1-carbaldehyde |
| SMILES | CCN1CCN(c2cccc3c2CN([C@H](CCCNc2cc(OC)cc(OC)n2)c2ccc(OC)c(OC)c2)C3C=O)CC1 |
| InChI | InChI=1S/C34H45N5O5/c1-6-37-15-17-38(18-16-37)29-10-7-9-26-27(29)22-39(30(26)23-40)28(24-12-13-31(42-3)32(19-24)43-4)11-8-14-35-33-20-25(41-2)21-34(36-33)44-5/h7,9-10,12-13,19-21,23,28,30H,6,8,11,14-18,22H2,1-5H3,(H,35,36)/t28-,30?/m1/s1 |
| InChIKey | UGEUBOPRRPHJPZ-KFMIKNBQSA-N |
| XLogP | 4.95 |
| TPSA | 88.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.76 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|