About phenyl 3-(2,4-dioxo-1,3-diazinan-1-yl)-4-methoxybenzoate
phenyl 3-(2,4-dioxo-1,3-diazinan-1-yl)-4-methoxybenzoate (PubChem CID 175264333) has the molecular formula C18H16N2O5
and a molecular weight of 340.34 g/mol. Its IUPAC name is phenyl 3-(2,4-dioxo-1,3-diazinan-1-yl)-4-methoxybenzoate.
Molecular Properties
| Compound Name | phenyl 3-(2,4-dioxo-1,3-diazinan-1-yl)-4-methoxybenzoate |
| PubChem CID | 175264333 |
| Molecular Formula | C18H16N2O5 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | phenyl 3-(2,4-dioxo-1,3-diazinan-1-yl)-4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccccc2)cc1N1CCC(=O)NC1=O |
| InChI | InChI=1S/C18H16N2O5/c1-24-15-8-7-12(17(22)25-13-5-3-2-4-6-13)11-14(15)20-10-9-16(21)19-18(20)23/h2-8,11H,9-10H2,1H3,(H,19,21,23) |
| InChIKey | JBGZUQLSXJAWBB-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze phenyl 3-(2,4-dioxo-1,3-diazinan-1-yl)-4-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl 3-(2,4-dioxo-1,3-diazinan-1-yl)-4-methoxybenzoate?
The IUPAC name of phenyl 3-(2,4-dioxo-1,3-diazinan-1-yl)-4-methoxybenzoate (CID 175264333) is phenyl 3-(2,4-dioxo-1,3-diazinan-1-yl)-4-methoxybenzoate.
What is the SMILES notation for phenyl 3-(2,4-dioxo-1,3-diazinan-1-yl)-4-methoxybenzoate?
The canonical SMILES for phenyl 3-(2,4-dioxo-1,3-diazinan-1-yl)-4-methoxybenzoate is COc1ccc(C(=O)Oc2ccccc2)cc1N1CCC(=O)NC1=O.
What is the InChIKey of phenyl 3-(2,4-dioxo-1,3-diazinan-1-yl)-4-methoxybenzoate?
The InChIKey is JBGZUQLSXJAWBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2O5/c1-24-15-8-7-12(17(22)25-13-5-3-2-4-6-13)11-14(15)20-10-9-16(21)19-18(20)23/h2-8,11H,9-10H2,1H3,(H,19,21,23).
What are the key properties of phenyl 3-(2,4-dioxo-1,3-diazinan-1-yl)-4-methoxybenzoate?
phenyl 3-(2,4-dioxo-1,3-diazinan-1-yl)-4-methoxybenzoate has a molecular weight of 340.34 g/mol, XLogP of 2.36, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl 3-(2,4-dioxo-1,3-diazinan-1-yl)-4-methoxybenzoate is sourced from PubChem (CID 175264333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).