C20H22ClNO7S — CID 175264520
[3-chloro-4-(2,6-dioxocyclohexanecarbonyl)-2-[5-(ethoxymethyl)-4,5-dihydro-1,2-oxazol-3-yl]phenyl]methanesulfinic acid (PubChem CID 175264520) has the molecular formula C20H22ClNO7S and a molecular weight of 455.92 g/mol. Its IUPAC name is [3-chloro-4-(2,6-dioxocyclohexanecarbonyl)-2-[5-(ethoxymethyl)-4,5-dihydro-1,2-oxazol-3-yl]phenyl]methanesulfinic acid.
| Compound Name | [3-chloro-4-(2,6-dioxocyclohexanecarbonyl)-2-[5-(ethoxymethyl)-4,5-dihydro-1,2-oxazol-3-yl]phenyl]methanesulfinic acid |
|---|---|
| PubChem CID | 175264520 |
| Molecular Formula | C20H22ClNO7S |
| Molecular Weight | 455.92 g/mol |
| Exact Mass | 455.08 |
| IUPAC Name | [3-chloro-4-(2,6-dioxocyclohexanecarbonyl)-2-[5-(ethoxymethyl)-4,5-dihydro-1,2-oxazol-3-yl]phenyl]methanesulfinic acid |
| SMILES | CCOCC1CC(c2c(CS(=O)O)ccc(C(=O)C3C(=O)CCCC3=O)c2Cl)=NO1 |
| InChI | InChI=1S/C20H22ClNO7S/c1-2-28-9-12-8-14(22-29-12)17-11(10-30(26)27)6-7-13(19(17)21)20(25)18-15(23)4-3-5-16(18)24/h6-7,12,18H,2-5,8-10H2,1H3,(H,26,27) |
| InChIKey | OHRPVLPMFBATAV-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 119.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.92 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|