About bicyclo[2.2.0]hexa-1,3,5-trien-2-ol;hydroiodide
bicyclo[2.2.0]hexa-1,3,5-trien-2-ol;hydroiodide (PubChem CID 175265565) has the molecular formula C6H5IO
and a molecular weight of 220.01 g/mol. Its IUPAC name is bicyclo[2.2.0]hexa-1,3,5-trien-2-ol;hydroiodide.
Molecular Properties
| Compound Name | bicyclo[2.2.0]hexa-1,3,5-trien-2-ol;hydroiodide |
| PubChem CID | 175265565 |
| Molecular Formula | C6H5IO |
| Molecular Weight | 220.01 g/mol |
| Exact Mass | 219.94 |
| IUPAC Name | bicyclo[2.2.0]hexa-1,3,5-trien-2-ol;hydroiodide |
| SMILES | I.Oc1cc2ccc1-2 |
| InChI | InChI=1S/C6H4O.HI/c7-6-3-4-1-2-5(4)6;/h1-3,7H;1H |
| InChIKey | SKVPIWCSSVABIN-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.01 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[2.2.0]hexa-1,3,5-trien-2-ol;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[2.2.0]hexa-1,3,5-trien-2-ol;hydroiodide?
The IUPAC name of bicyclo[2.2.0]hexa-1,3,5-trien-2-ol;hydroiodide (CID 175265565) is bicyclo[2.2.0]hexa-1,3,5-trien-2-ol;hydroiodide.
What is the SMILES notation for bicyclo[2.2.0]hexa-1,3,5-trien-2-ol;hydroiodide?
The canonical SMILES for bicyclo[2.2.0]hexa-1,3,5-trien-2-ol;hydroiodide is I.Oc1cc2ccc1-2.
What is the InChIKey of bicyclo[2.2.0]hexa-1,3,5-trien-2-ol;hydroiodide?
The InChIKey is SKVPIWCSSVABIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4O.HI/c7-6-3-4-1-2-5(4)6;/h1-3,7H;1H.
What are the key properties of bicyclo[2.2.0]hexa-1,3,5-trien-2-ol;hydroiodide?
bicyclo[2.2.0]hexa-1,3,5-trien-2-ol;hydroiodide has a molecular weight of 220.01 g/mol, XLogP of 1.99, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.0]hexa-1,3,5-trien-2-ol;hydroiodide is sourced from PubChem (CID 175265565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).