About 2-(3-prop-2-enyl-1,4-dioxin-2-yl)pyrazine
2-(3-prop-2-enyl-1,4-dioxin-2-yl)pyrazine (PubChem CID 175265567) has the molecular formula C11H10N2O2
and a molecular weight of 202.21 g/mol. Its IUPAC name is 2-(3-prop-2-enyl-1,4-dioxin-2-yl)pyrazine.
Molecular Properties
| Compound Name | 2-(3-prop-2-enyl-1,4-dioxin-2-yl)pyrazine |
| PubChem CID | 175265567 |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 2-(3-prop-2-enyl-1,4-dioxin-2-yl)pyrazine |
| SMILES | C=CCC1=C(c2cnccn2)OC=CO1 |
| InChI | InChI=1S/C11H10N2O2/c1-2-3-10-11(15-7-6-14-10)9-8-12-4-5-13-9/h2,4-8H,1,3H2 |
| InChIKey | DYPQNQWCMZMCHG-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-prop-2-enyl-1,4-dioxin-2-yl)pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-prop-2-enyl-1,4-dioxin-2-yl)pyrazine?
The IUPAC name of 2-(3-prop-2-enyl-1,4-dioxin-2-yl)pyrazine (CID 175265567) is 2-(3-prop-2-enyl-1,4-dioxin-2-yl)pyrazine.
What is the SMILES notation for 2-(3-prop-2-enyl-1,4-dioxin-2-yl)pyrazine?
The canonical SMILES for 2-(3-prop-2-enyl-1,4-dioxin-2-yl)pyrazine is C=CCC1=C(c2cnccn2)OC=CO1.
What is the InChIKey of 2-(3-prop-2-enyl-1,4-dioxin-2-yl)pyrazine?
The InChIKey is DYPQNQWCMZMCHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O2/c1-2-3-10-11(15-7-6-14-10)9-8-12-4-5-13-9/h2,4-8H,1,3H2.
What are the key properties of 2-(3-prop-2-enyl-1,4-dioxin-2-yl)pyrazine?
2-(3-prop-2-enyl-1,4-dioxin-2-yl)pyrazine has a molecular weight of 202.21 g/mol, XLogP of 2.24, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-prop-2-enyl-1,4-dioxin-2-yl)pyrazine is sourced from PubChem (CID 175265567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).