C10H17NO5 — CID 175265990
2-hydroxy-2-methyl-4-[(2-methylpropan-2-yl)oxycarbonylimino]butanoic acid (PubChem CID 175265990) has the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. Its IUPAC name is 2-hydroxy-2-methyl-4-[(2-methylpropan-2-yl)oxycarbonylimino]butanoic acid.
| Compound Name | 2-hydroxy-2-methyl-4-[(2-methylpropan-2-yl)oxycarbonylimino]butanoic acid |
|---|---|
| PubChem CID | 175265990 |
| Molecular Formula | C10H17NO5 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | 2-hydroxy-2-methyl-4-[(2-methylpropan-2-yl)oxycarbonylimino]butanoic acid |
| SMILES | CC(C)(C)OC(=O)N=CCC(C)(O)C(=O)O |
| InChI | InChI=1S/C10H17NO5/c1-9(2,3)16-8(14)11-6-5-10(4,15)7(12)13/h6,15H,5H2,1-4H3,(H,12,13) |
| InChIKey | VJMOAISKYFQYEH-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 96.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|