About 4-bromobenzaldehyde;nitrous acid
4-bromobenzaldehyde;nitrous acid (PubChem CID 175266489) has the molecular formula C7H6BrNO3
and a molecular weight of 232.03 g/mol. Its IUPAC name is 4-bromobenzaldehyde;nitrous acid.
Molecular Properties
| Compound Name | 4-bromobenzaldehyde;nitrous acid |
| PubChem CID | 175266489 |
| Molecular Formula | C7H6BrNO3 |
| Molecular Weight | 232.03 g/mol |
| Exact Mass | 230.95 |
| IUPAC Name | 4-bromobenzaldehyde;nitrous acid |
| SMILES | O=Cc1ccc(Br)cc1.O=NO |
| InChI | InChI=1S/C7H5BrO.HNO2/c8-7-3-1-6(5-9)2-4-7;2-1-3/h1-5H;(H,2,3) |
| InChIKey | WZOMQEJHHVNERD-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.03 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-bromobenzaldehyde;nitrous acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromobenzaldehyde;nitrous acid?
The IUPAC name of 4-bromobenzaldehyde;nitrous acid (CID 175266489) is 4-bromobenzaldehyde;nitrous acid.
What is the SMILES notation for 4-bromobenzaldehyde;nitrous acid?
The canonical SMILES for 4-bromobenzaldehyde;nitrous acid is O=Cc1ccc(Br)cc1.O=NO.
What is the InChIKey of 4-bromobenzaldehyde;nitrous acid?
The InChIKey is WZOMQEJHHVNERD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5BrO.HNO2/c8-7-3-1-6(5-9)2-4-7;2-1-3/h1-5H;(H,2,3).
What are the key properties of 4-bromobenzaldehyde;nitrous acid?
4-bromobenzaldehyde;nitrous acid has a molecular weight of 232.03 g/mol, XLogP of 2.40, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromobenzaldehyde;nitrous acid is sourced from PubChem (CID 175266489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).