C7H11NO2 — CID 175266856
2-amino-3-[(1R)-2-methylidenecyclopropyl]propanoic acid (PubChem CID 175266856) has the molecular formula C7H11NO2 and a molecular weight of 141.17 g/mol. Its IUPAC name is 2-amino-3-[(1R)-2-methylidenecyclopropyl]propanoic acid.
| Compound Name | 2-amino-3-[(1R)-2-methylidenecyclopropyl]propanoic acid |
|---|---|
| PubChem CID | 175266856 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | 2-amino-3-[(1R)-2-methylidenecyclopropyl]propanoic acid |
| SMILES | C=C1C[C@@H]1CC(N)C(=O)O |
| InChI | InChI=1S/C7H11NO2/c1-4-2-5(4)3-6(8)7(9)10/h5-6H,1-3,8H2,(H,9,10)/t5-,6?/m1/s1 |
| InChIKey | OOJZCXFXPZGUBJ-LWOQYNTDSA-N |
| XLogP | 0.36 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|