About 2-ethyl-1,4-dimethyl-2H-pyridin-3-ol
2-ethyl-1,4-dimethyl-2H-pyridin-3-ol (PubChem CID 175267353) has the molecular formula C9H15NO
and a molecular weight of 153.22 g/mol. Its IUPAC name is 2-ethyl-1,4-dimethyl-2H-pyridin-3-ol.
Molecular Properties
| Compound Name | 2-ethyl-1,4-dimethyl-2H-pyridin-3-ol |
| PubChem CID | 175267353 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 2-ethyl-1,4-dimethyl-2H-pyridin-3-ol |
| SMILES | CCC1C(O)=C(C)C=CN1C |
| InChI | InChI=1S/C9H15NO/c1-4-8-9(11)7(2)5-6-10(8)3/h5-6,8,11H,4H2,1-3H3 |
| InChIKey | PNHBUVUXBQRILH-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethyl-1,4-dimethyl-2H-pyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-1,4-dimethyl-2H-pyridin-3-ol?
The IUPAC name of 2-ethyl-1,4-dimethyl-2H-pyridin-3-ol (CID 175267353) is 2-ethyl-1,4-dimethyl-2H-pyridin-3-ol.
What is the SMILES notation for 2-ethyl-1,4-dimethyl-2H-pyridin-3-ol?
The canonical SMILES for 2-ethyl-1,4-dimethyl-2H-pyridin-3-ol is CCC1C(O)=C(C)C=CN1C.
What is the InChIKey of 2-ethyl-1,4-dimethyl-2H-pyridin-3-ol?
The InChIKey is PNHBUVUXBQRILH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO/c1-4-8-9(11)7(2)5-6-10(8)3/h5-6,8,11H,4H2,1-3H3.
What are the key properties of 2-ethyl-1,4-dimethyl-2H-pyridin-3-ol?
2-ethyl-1,4-dimethyl-2H-pyridin-3-ol has a molecular weight of 153.22 g/mol, XLogP of 2.06, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-1,4-dimethyl-2H-pyridin-3-ol is sourced from PubChem (CID 175267353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).