About 1H-pyrrole;thianthrene
1H-pyrrole;thianthrene (PubChem CID 175267663) has the molecular formula C16H13NS2
and a molecular weight of 283.42 g/mol. Its IUPAC name is 1H-pyrrole;thianthrene.
Molecular Properties
| Compound Name | 1H-pyrrole;thianthrene |
| PubChem CID | 175267663 |
| Molecular Formula | C16H13NS2 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 1H-pyrrole;thianthrene |
| SMILES | c1cc[nH]c1.c1ccc2c(c1)Sc1ccccc1S2 |
| InChI | InChI=1S/C12H8S2.C4H5N/c1-2-6-10-9(5-1)13-11-7-3-4-8-12(11)14-10;1-2-4-5-3-1/h1-8H;1-5H |
| InChIKey | VHLMLRJSPDOWSL-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1H-pyrrole;thianthrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrrole;thianthrene?
The IUPAC name of 1H-pyrrole;thianthrene (CID 175267663) is 1H-pyrrole;thianthrene.
What is the SMILES notation for 1H-pyrrole;thianthrene?
The canonical SMILES for 1H-pyrrole;thianthrene is c1cc[nH]c1.c1ccc2c(c1)Sc1ccccc1S2.
What is the InChIKey of 1H-pyrrole;thianthrene?
The InChIKey is VHLMLRJSPDOWSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8S2.C4H5N/c1-2-6-10-9(5-1)13-11-7-3-4-8-12(11)14-10;1-2-4-5-3-1/h1-8H;1-5H.
What are the key properties of 1H-pyrrole;thianthrene?
1H-pyrrole;thianthrene has a molecular weight of 283.42 g/mol, XLogP of 5.32, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrrole;thianthrene is sourced from PubChem (CID 175267663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).