C19H23NO5 — CID 175268729
benzene-1,3-dicarboxylic acid;N-ethyl-4-propoxyaniline (PubChem CID 175268729) has the molecular formula C19H23NO5 and a molecular weight of 345.40 g/mol. Its IUPAC name is benzene-1,3-dicarboxylic acid;N-ethyl-4-propoxyaniline.
| Compound Name | benzene-1,3-dicarboxylic acid;N-ethyl-4-propoxyaniline |
|---|---|
| PubChem CID | 175268729 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | benzene-1,3-dicarboxylic acid;N-ethyl-4-propoxyaniline |
| SMILES | CCCOc1ccc(NCC)cc1.O=C(O)c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C11H17NO.C8H6O4/c1-3-9-13-11-7-5-10(6-8-11)12-4-2;9-7(10)5-2-1-3-6(4-5)8(11)12/h5-8,12H,3-4,9H2,1-2H3;1-4H,(H,9,10)(H,11,12) |
| InChIKey | IDPZUKODVAFMKF-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|