C25H29N3O — CID 175269067
3-[(dimethylamino)methyl]-2-methyl-N-[1-(6-methyl-3-pyridinyl)ethyl]-5-phenylbenzamide (PubChem CID 175269067) has the molecular formula C25H29N3O and a molecular weight of 387.53 g/mol. Its IUPAC name is 3-[(dimethylamino)methyl]-2-methyl-N-[1-(6-methyl-3-pyridinyl)ethyl]-5-phenylbenzamide.
| Compound Name | 3-[(dimethylamino)methyl]-2-methyl-N-[1-(6-methyl-3-pyridinyl)ethyl]-5-phenylbenzamide |
|---|---|
| PubChem CID | 175269067 |
| Molecular Formula | C25H29N3O |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | 3-[(dimethylamino)methyl]-2-methyl-N-[1-(6-methyl-3-pyridinyl)ethyl]-5-phenylbenzamide |
| SMILES | Cc1ccc(C(C)NC(=O)c2cc(-c3ccccc3)cc(CN(C)C)c2C)cn1 |
| InChI | InChI=1S/C25H29N3O/c1-17-11-12-21(15-26-17)19(3)27-25(29)24-14-22(20-9-7-6-8-10-20)13-23(18(24)2)16-28(4)5/h6-15,19H,16H2,1-5H3,(H,27,29) |
| InChIKey | HPVQEDDFJFKHKG-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |