C17H27NO2 — CID 175269442
1-oxido-2,2,6,6-tetrakis(prop-2-enyl)piperidin-1-ium-4-ol (PubChem CID 175269442) has the molecular formula C17H27NO2 and a molecular weight of 277.41 g/mol. Its IUPAC name is 1-oxido-2,2,6,6-tetrakis(prop-2-enyl)piperidin-1-ium-4-ol.
| Compound Name | 1-oxido-2,2,6,6-tetrakis(prop-2-enyl)piperidin-1-ium-4-ol |
|---|---|
| PubChem CID | 175269442 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | 1-oxido-2,2,6,6-tetrakis(prop-2-enyl)piperidin-1-ium-4-ol |
| SMILES | C=CCC1(CC=C)CC(O)CC(CC=C)(CC=C)[NH+]1[O-] |
| InChI | InChI=1S/C17H27NO2/c1-5-9-16(10-6-2)13-15(19)14-17(11-7-3,12-8-4)18(16)20/h5-8,15,18-19H,1-4,9-14H2 |
| InChIKey | WACHFAXAWZYZSP-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 47.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|