C17H26NO2- — CID 175269443
1-oxido-2,2,6,6-tetrakis(prop-2-enyl)piperidin-4-ol (PubChem CID 175269443) has the molecular formula C17H26NO2- and a molecular weight of 276.40 g/mol. Its IUPAC name is 1-oxido-2,2,6,6-tetrakis(prop-2-enyl)piperidin-4-ol.
| Compound Name | 1-oxido-2,2,6,6-tetrakis(prop-2-enyl)piperidin-4-ol |
|---|---|
| PubChem CID | 175269443 |
| Molecular Formula | C17H26NO2- |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | 1-oxido-2,2,6,6-tetrakis(prop-2-enyl)piperidin-4-ol |
| SMILES | C=CCC1(CC=C)CC(O)CC(CC=C)(CC=C)N1[O-] |
| InChI | InChI=1S/C17H26NO2/c1-5-9-16(10-6-2)13-15(19)14-17(11-7-3,12-8-4)18(16)20/h5-8,15,19H,1-4,9-14H2/q-1 |
| InChIKey | RDRRIXSJWWYCGN-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|