About 4-butan-2-yl-2-[(1,2-diaminocyclopentyl)methyl]-6-(propan-2-yliminomethyl)phenol
4-butan-2-yl-2-[(1,2-diaminocyclopentyl)methyl]-6-(propan-2-yliminomethyl)phenol (PubChem CID 175269549) has the molecular formula C20H33N3O
and a molecular weight of 331.50 g/mol. Its IUPAC name is 4-butan-2-yl-2-[(1,2-diaminocyclopentyl)methyl]-6-(propan-2-yliminomethyl)phenol.
Molecular Properties
| Compound Name | 4-butan-2-yl-2-[(1,2-diaminocyclopentyl)methyl]-6-(propan-2-yliminomethyl)phenol |
| PubChem CID | 175269549 |
| Molecular Formula | C20H33N3O |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.26 |
| IUPAC Name | 4-butan-2-yl-2-[(1,2-diaminocyclopentyl)methyl]-6-(propan-2-yliminomethyl)phenol |
| SMILES | CCC(C)c1cc(/C=N/C(C)C)c(O)c(CC2(N)CCCC2N)c1 |
| InChI | InChI=1S/C20H33N3O/c1-5-14(4)15-9-16(11-20(22)8-6-7-18(20)21)19(24)17(10-15)12-23-13(2)3/h9-10,12-14,18,24H,5-8,11,21-22H2,1-4H3/b23-12+ |
| InChIKey | WGDJKGOUAIYFSL-FSJBWODESA-N |
| XLogP | 3.48 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-butan-2-yl-2-[(1,2-diaminocyclopentyl)methyl]-6-(propan-2-yliminomethyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butan-2-yl-2-[(1,2-diaminocyclopentyl)methyl]-6-(propan-2-yliminomethyl)phenol?
The IUPAC name of 4-butan-2-yl-2-[(1,2-diaminocyclopentyl)methyl]-6-(propan-2-yliminomethyl)phenol (CID 175269549) is 4-butan-2-yl-2-[(1,2-diaminocyclopentyl)methyl]-6-(propan-2-yliminomethyl)phenol.
What is the SMILES notation for 4-butan-2-yl-2-[(1,2-diaminocyclopentyl)methyl]-6-(propan-2-yliminomethyl)phenol?
The canonical SMILES for 4-butan-2-yl-2-[(1,2-diaminocyclopentyl)methyl]-6-(propan-2-yliminomethyl)phenol is CCC(C)c1cc(/C=N/C(C)C)c(O)c(CC2(N)CCCC2N)c1.
What is the InChIKey of 4-butan-2-yl-2-[(1,2-diaminocyclopentyl)methyl]-6-(propan-2-yliminomethyl)phenol?
The InChIKey is WGDJKGOUAIYFSL-FSJBWODESA-N. The full InChI is InChI=1S/C20H33N3O/c1-5-14(4)15-9-16(11-20(22)8-6-7-18(20)21)19(24)17(10-15)12-23-13(2)3/h9-10,12-14,18,24H,5-8,11,21-22H2,1-4H3/b23-12+.
What are the key properties of 4-butan-2-yl-2-[(1,2-diaminocyclopentyl)methyl]-6-(propan-2-yliminomethyl)phenol?
4-butan-2-yl-2-[(1,2-diaminocyclopentyl)methyl]-6-(propan-2-yliminomethyl)phenol has a molecular weight of 331.50 g/mol, XLogP of 3.48, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butan-2-yl-2-[(1,2-diaminocyclopentyl)methyl]-6-(propan-2-yliminomethyl)phenol is sourced from PubChem (CID 175269549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).